C26H26ClN5O — CID 50939856
N-[3-[3-[2-chloro-6-(cyclohexylamino)-4-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]acetamide (PubChem CID 50939856) has the molecular formula C26H26ClN5O and a molecular weight of 459.98 g/mol. Its IUPAC name is N-[3-[3-[2-chloro-6-(cyclohexylamino)-4-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]acetamide.
| Compound Name | N-[3-[3-[2-chloro-6-(cyclohexylamino)-4-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 50939856 |
| Molecular Formula | C26H26ClN5O |
| Molecular Weight | 459.98 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | N-[3-[3-[2-chloro-6-(cyclohexylamino)-4-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(-c2cnc3[nH]cc(-c4cc(Cl)nc(NC5CCCCC5)c4)c3c2)c1 |
| InChI | InChI=1S/C26H26ClN5O/c1-16(33)30-21-9-5-6-17(10-21)19-11-22-23(15-29-26(22)28-14-19)18-12-24(27)32-25(13-18)31-20-7-3-2-4-8-20/h5-6,9-15,20H,2-4,7-8H2,1H3,(H,28,29)(H,30,33)(H,31,32) |
| InChIKey | SDXGQVBZDRQVAK-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.98 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|