About 4-[3,3-dimethyl-1-(3-methyl-2-phenylquinolin-4-yl)-2H-indol-6-yl]morpholine
4-[3,3-dimethyl-1-(3-methyl-2-phenylquinolin-4-yl)-2H-indol-6-yl]morpholine (PubChem CID 50939865) has the molecular formula C30H31N3O
and a molecular weight of 449.60 g/mol. Its IUPAC name is 4-[3,3-dimethyl-1-(3-methyl-2-phenylquinolin-4-yl)-2H-indol-6-yl]morpholine.
Molecular Properties
| Compound Name | 4-[3,3-dimethyl-1-(3-methyl-2-phenylquinolin-4-yl)-2H-indol-6-yl]morpholine |
| PubChem CID | 50939865 |
| Molecular Formula | C30H31N3O |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | 4-[3,3-dimethyl-1-(3-methyl-2-phenylquinolin-4-yl)-2H-indol-6-yl]morpholine |
| SMILES | Cc1c(-c2ccccc2)nc2ccccc2c1N1CC(C)(C)c2ccc(N3CCOCC3)cc21 |
| InChI | InChI=1S/C30H31N3O/c1-21-28(22-9-5-4-6-10-22)31-26-12-8-7-11-24(26)29(21)33-20-30(2,3)25-14-13-23(19-27(25)33)32-15-17-34-18-16-32/h4-14,19H,15-18,20H2,1-3H3 |
| InChIKey | ACWBFWBJDDHSBS-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[3,3-dimethyl-1-(3-methyl-2-phenylquinolin-4-yl)-2H-indol-6-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3,3-dimethyl-1-(3-methyl-2-phenylquinolin-4-yl)-2H-indol-6-yl]morpholine?
The IUPAC name of 4-[3,3-dimethyl-1-(3-methyl-2-phenylquinolin-4-yl)-2H-indol-6-yl]morpholine (CID 50939865) is 4-[3,3-dimethyl-1-(3-methyl-2-phenylquinolin-4-yl)-2H-indol-6-yl]morpholine.
What is the SMILES notation for 4-[3,3-dimethyl-1-(3-methyl-2-phenylquinolin-4-yl)-2H-indol-6-yl]morpholine?
The canonical SMILES for 4-[3,3-dimethyl-1-(3-methyl-2-phenylquinolin-4-yl)-2H-indol-6-yl]morpholine is Cc1c(-c2ccccc2)nc2ccccc2c1N1CC(C)(C)c2ccc(N3CCOCC3)cc21.
What is the InChIKey of 4-[3,3-dimethyl-1-(3-methyl-2-phenylquinolin-4-yl)-2H-indol-6-yl]morpholine?
The InChIKey is ACWBFWBJDDHSBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H31N3O/c1-21-28(22-9-5-4-6-10-22)31-26-12-8-7-11-24(26)29(21)33-20-30(2,3)25-14-13-23(19-27(25)33)32-15-17-34-18-16-32/h4-14,19H,15-18,20H2,1-3H3.
What are the key properties of 4-[3,3-dimethyl-1-(3-methyl-2-phenylquinolin-4-yl)-2H-indol-6-yl]morpholine?
4-[3,3-dimethyl-1-(3-methyl-2-phenylquinolin-4-yl)-2H-indol-6-yl]morpholine has a molecular weight of 449.60 g/mol, XLogP of 6.48, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3,3-dimethyl-1-(3-methyl-2-phenylquinolin-4-yl)-2H-indol-6-yl]morpholine is sourced from PubChem (CID 50939865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).