C25H33NO4 — CID 50940013
4-[4-[2-[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylamino]-2-oxoethylidene]cyclohexyl]oxybenzoic acid (PubChem CID 50940013) has the molecular formula C25H33NO4 and a molecular weight of 411.54 g/mol. Its IUPAC name is 4-[4-[2-[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylamino]-2-oxoethylidene]cyclohexyl]oxybenzoic acid.
| Compound Name | 4-[4-[2-[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylamino]-2-oxoethylidene]cyclohexyl]oxybenzoic acid |
|---|---|
| PubChem CID | 50940013 |
| Molecular Formula | C25H33NO4 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 4-[4-[2-[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylamino]-2-oxoethylidene]cyclohexyl]oxybenzoic acid |
| SMILES | CC1(C)[C@H]2CC[C@@H](CNC(=O)C=C3CCC(Oc4ccc(C(=O)O)cc4)CC3)[C@@H]1C2 |
| InChI | InChI=1S/C25H33NO4/c1-25(2)19-8-5-18(22(25)14-19)15-26-23(27)13-16-3-9-20(10-4-16)30-21-11-6-17(7-12-21)24(28)29/h6-7,11-13,18-20,22H,3-5,8-10,14-15H2,1-2H3,(H,26,27)(H,28,29)/b16-13-/t18-,19-,20?,22-/m0/s1 |
| InChIKey | UFYHALKVCSTPDM-ZLNVDVSLSA-N |
| XLogP | 4.82 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|