C25H29N3O3 — CID 50940050
2-[3,3,4,4-tetradeuterio-4-[(5,6-diphenylpyrazin-2-yl)-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)amino]butoxy]acetic acid (PubChem CID 50940050) has the molecular formula C25H29N3O3 and a molecular weight of 429.59 g/mol. Its IUPAC name is 2-[3,3,4,4-tetradeuterio-4-[(5,6-diphenylpyrazin-2-yl)-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)amino]butoxy]acetic acid.
| Compound Name | 2-[3,3,4,4-tetradeuterio-4-[(5,6-diphenylpyrazin-2-yl)-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)amino]butoxy]acetic acid |
|---|---|
| PubChem CID | 50940050 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.28 |
| IUPAC Name | 2-[3,3,4,4-tetradeuterio-4-[(5,6-diphenylpyrazin-2-yl)-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)amino]butoxy]acetic acid |
| SMILES | [2H]C([2H])([2H])C(N(c1cnc(-c2ccccc2)c(-c2ccccc2)n1)C([2H])([2H])C([2H])([2H])CCOCC(=O)O)C([2H])([2H])[2H] |
| InChI | InChI=1S/C25H29N3O3/c1-19(2)28(15-9-10-16-31-18-23(29)30)22-17-26-24(20-11-5-3-6-12-20)25(27-22)21-13-7-4-8-14-21/h3-8,11-14,17,19H,9-10,15-16,18H2,1-2H3,(H,29,30)/i1D3,2D3,9D2,15D2 |
| InChIKey | OJQMKCBWYCWFPU-SLWSFHOWSA-N |
| XLogP | 4.91 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|