C23H23ClN6O2S — CID 50940215
N-[3-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]pyridine-3-sulfonamide (PubChem CID 50940215) has the molecular formula C23H23ClN6O2S and a molecular weight of 483.00 g/mol. Its IUPAC name is N-[3-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]pyridine-3-sulfonamide.
| Compound Name | N-[3-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 50940215 |
| Molecular Formula | C23H23ClN6O2S |
| Molecular Weight | 483.00 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | N-[3-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NC1CCCC(Nc2cc(-c3c[nH]c4ncccc34)cc(Cl)n2)C1)c1cccnc1 |
| InChI | InChI=1S/C23H23ClN6O2S/c24-21-10-15(20-14-27-23-19(20)7-3-9-26-23)11-22(29-21)28-16-4-1-5-17(12-16)30-33(31,32)18-6-2-8-25-13-18/h2-3,6-11,13-14,16-17,30H,1,4-5,12H2,(H,26,27)(H,28,29) |
| InChIKey | KZRAGSCGFJWQGE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.00 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|