About 1-(6-chloro-2,3-dimethylquinolin-4-yl)-6-pyridin-4-ylindole-4-carbonitrile
1-(6-chloro-2,3-dimethylquinolin-4-yl)-6-pyridin-4-ylindole-4-carbonitrile (PubChem CID 50940225) has the molecular formula C25H17ClN4
and a molecular weight of 408.89 g/mol. Its IUPAC name is 1-(6-chloro-2,3-dimethylquinolin-4-yl)-6-pyridin-4-ylindole-4-carbonitrile.
Molecular Properties
| Compound Name | 1-(6-chloro-2,3-dimethylquinolin-4-yl)-6-pyridin-4-ylindole-4-carbonitrile |
| PubChem CID | 50940225 |
| Molecular Formula | C25H17ClN4 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 1-(6-chloro-2,3-dimethylquinolin-4-yl)-6-pyridin-4-ylindole-4-carbonitrile |
| SMILES | Cc1nc2ccc(Cl)cc2c(-n2ccc3c(C#N)cc(-c4ccncc4)cc32)c1C |
| InChI | InChI=1S/C25H17ClN4/c1-15-16(2)29-23-4-3-20(26)13-22(23)25(15)30-10-7-21-19(14-27)11-18(12-24(21)30)17-5-8-28-9-6-17/h3-13H,1-2H3 |
| InChIKey | PUCGIXDPDICKQW-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(6-chloro-2,3-dimethylquinolin-4-yl)-6-pyridin-4-ylindole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-chloro-2,3-dimethylquinolin-4-yl)-6-pyridin-4-ylindole-4-carbonitrile?
The IUPAC name of 1-(6-chloro-2,3-dimethylquinolin-4-yl)-6-pyridin-4-ylindole-4-carbonitrile (CID 50940225) is 1-(6-chloro-2,3-dimethylquinolin-4-yl)-6-pyridin-4-ylindole-4-carbonitrile.
What is the SMILES notation for 1-(6-chloro-2,3-dimethylquinolin-4-yl)-6-pyridin-4-ylindole-4-carbonitrile?
The canonical SMILES for 1-(6-chloro-2,3-dimethylquinolin-4-yl)-6-pyridin-4-ylindole-4-carbonitrile is Cc1nc2ccc(Cl)cc2c(-n2ccc3c(C#N)cc(-c4ccncc4)cc32)c1C.
What is the InChIKey of 1-(6-chloro-2,3-dimethylquinolin-4-yl)-6-pyridin-4-ylindole-4-carbonitrile?
The InChIKey is PUCGIXDPDICKQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H17ClN4/c1-15-16(2)29-23-4-3-20(26)13-22(23)25(15)30-10-7-21-19(14-27)11-18(12-24(21)30)17-5-8-28-9-6-17/h3-13H,1-2H3.
What are the key properties of 1-(6-chloro-2,3-dimethylquinolin-4-yl)-6-pyridin-4-ylindole-4-carbonitrile?
1-(6-chloro-2,3-dimethylquinolin-4-yl)-6-pyridin-4-ylindole-4-carbonitrile has a molecular weight of 408.89 g/mol, XLogP of 6.38, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-chloro-2,3-dimethylquinolin-4-yl)-6-pyridin-4-ylindole-4-carbonitrile is sourced from PubChem (CID 50940225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).