C20H25ClN4O6 — CID 50940611
2-(4-nitrophenyl)-1-octylimidazo[1,2-a]pyrimidin-4-ium perchlorate (PubChem CID 50940611) has the molecular formula C20H25ClN4O6 and a molecular weight of 452.90 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-1-octylimidazo[1,2-a]pyrimidin-4-ium perchlorate.
| Compound Name | 2-(4-nitrophenyl)-1-octylimidazo[1,2-a]pyrimidin-4-ium perchlorate |
|---|---|
| PubChem CID | 50940611 |
| Molecular Formula | C20H25ClN4O6 |
| Molecular Weight | 452.90 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 2-(4-nitrophenyl)-1-octylimidazo[1,2-a]pyrimidin-4-ium perchlorate |
| SMILES | CCCCCCCCn1c(-c2ccc([N+](=O)[O-])cc2)c[n+]2cccnc12.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C20H25N4O2.ClHO4/c1-2-3-4-5-6-7-15-23-19(16-22-14-8-13-21-20(22)23)17-9-11-18(12-10-17)24(25)26;2-1(3,4)5/h8-14,16H,2-7,15H2,1H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | XBZOVONHTCYWOS-UHFFFAOYSA-M |
| XLogP | -0.20 |
| TPSA | 157.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.90 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|