C23H28N2O3 — CID 50940761
N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-2-methyl-2,3-dihydro-1-benzofuran-4-carbohydrazide (PubChem CID 50940761) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-2-methyl-2,3-dihydro-1-benzofuran-4-carbohydrazide.
| Compound Name | N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-2-methyl-2,3-dihydro-1-benzofuran-4-carbohydrazide |
|---|---|
| PubChem CID | 50940761 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-2-methyl-2,3-dihydro-1-benzofuran-4-carbohydrazide |
| SMILES | Cc1cc(C)cc(C(=O)N(NC(=O)c2cccc3c2CC(C)O3)C(C)(C)C)c1 |
| InChI | InChI=1S/C23H28N2O3/c1-14-10-15(2)12-17(11-14)22(27)25(23(4,5)6)24-21(26)18-8-7-9-20-19(18)13-16(3)28-20/h7-12,16H,13H2,1-6H3,(H,24,26) |
| InChIKey | BUNWEWRCVFOTMK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|