About N-[2,6-bis(4-methylsulfanylphenyl)pyrimidin-4-yl]acetamide
N-[2,6-bis(4-methylsulfanylphenyl)pyrimidin-4-yl]acetamide (PubChem CID 50940949) has the molecular formula C20H19N3OS2
and a molecular weight of 381.53 g/mol. Its IUPAC name is N-[2,6-bis(4-methylsulfanylphenyl)pyrimidin-4-yl]acetamide.
Molecular Properties
| Compound Name | N-[2,6-bis(4-methylsulfanylphenyl)pyrimidin-4-yl]acetamide |
| PubChem CID | 50940949 |
| Molecular Formula | C20H19N3OS2 |
| Molecular Weight | 381.53 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | N-[2,6-bis(4-methylsulfanylphenyl)pyrimidin-4-yl]acetamide |
| SMILES | CSc1ccc(-c2cc(NC(C)=O)nc(-c3ccc(SC)cc3)n2)cc1 |
| InChI | InChI=1S/C20H19N3OS2/c1-13(24)21-19-12-18(14-4-8-16(25-2)9-5-14)22-20(23-19)15-6-10-17(26-3)11-7-15/h4-12H,1-3H3,(H,21,22,23,24) |
| InChIKey | IHOJPHVYVFXUNM-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.53 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2,6-bis(4-methylsulfanylphenyl)pyrimidin-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,6-bis(4-methylsulfanylphenyl)pyrimidin-4-yl]acetamide?
The IUPAC name of N-[2,6-bis(4-methylsulfanylphenyl)pyrimidin-4-yl]acetamide (CID 50940949) is N-[2,6-bis(4-methylsulfanylphenyl)pyrimidin-4-yl]acetamide.
What is the SMILES notation for N-[2,6-bis(4-methylsulfanylphenyl)pyrimidin-4-yl]acetamide?
The canonical SMILES for N-[2,6-bis(4-methylsulfanylphenyl)pyrimidin-4-yl]acetamide is CSc1ccc(-c2cc(NC(C)=O)nc(-c3ccc(SC)cc3)n2)cc1.
What is the InChIKey of N-[2,6-bis(4-methylsulfanylphenyl)pyrimidin-4-yl]acetamide?
The InChIKey is IHOJPHVYVFXUNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3OS2/c1-13(24)21-19-12-18(14-4-8-16(25-2)9-5-14)22-20(23-19)15-6-10-17(26-3)11-7-15/h4-12H,1-3H3,(H,21,22,23,24).
What are the key properties of N-[2,6-bis(4-methylsulfanylphenyl)pyrimidin-4-yl]acetamide?
N-[2,6-bis(4-methylsulfanylphenyl)pyrimidin-4-yl]acetamide has a molecular weight of 381.53 g/mol, XLogP of 5.21, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,6-bis(4-methylsulfanylphenyl)pyrimidin-4-yl]acetamide is sourced from PubChem (CID 50940949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).