About N-[2,6-bis(1,3-benzodioxol-5-yl)pyrimidin-4-yl]propanamide
N-[2,6-bis(1,3-benzodioxol-5-yl)pyrimidin-4-yl]propanamide (PubChem CID 50940976) has the molecular formula C21H17N3O5
and a molecular weight of 391.38 g/mol. Its IUPAC name is N-[2,6-bis(1,3-benzodioxol-5-yl)pyrimidin-4-yl]propanamide.
Molecular Properties
| Compound Name | N-[2,6-bis(1,3-benzodioxol-5-yl)pyrimidin-4-yl]propanamide |
| PubChem CID | 50940976 |
| Molecular Formula | C21H17N3O5 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | N-[2,6-bis(1,3-benzodioxol-5-yl)pyrimidin-4-yl]propanamide |
| SMILES | CCC(=O)Nc1cc(-c2ccc3c(c2)OCO3)nc(-c2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C21H17N3O5/c1-2-20(25)23-19-9-14(12-3-5-15-17(7-12)28-10-26-15)22-21(24-19)13-4-6-16-18(8-13)29-11-27-16/h3-9H,2,10-11H2,1H3,(H,22,23,24,25) |
| InChIKey | FPGLLUINTXSLFA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[2,6-bis(1,3-benzodioxol-5-yl)pyrimidin-4-yl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,6-bis(1,3-benzodioxol-5-yl)pyrimidin-4-yl]propanamide?
The IUPAC name of N-[2,6-bis(1,3-benzodioxol-5-yl)pyrimidin-4-yl]propanamide (CID 50940976) is N-[2,6-bis(1,3-benzodioxol-5-yl)pyrimidin-4-yl]propanamide.
What is the SMILES notation for N-[2,6-bis(1,3-benzodioxol-5-yl)pyrimidin-4-yl]propanamide?
The canonical SMILES for N-[2,6-bis(1,3-benzodioxol-5-yl)pyrimidin-4-yl]propanamide is CCC(=O)Nc1cc(-c2ccc3c(c2)OCO3)nc(-c2ccc3c(c2)OCO3)n1.
What is the InChIKey of N-[2,6-bis(1,3-benzodioxol-5-yl)pyrimidin-4-yl]propanamide?
The InChIKey is FPGLLUINTXSLFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17N3O5/c1-2-20(25)23-19-9-14(12-3-5-15-17(7-12)28-10-26-15)22-21(24-19)13-4-6-16-18(8-13)29-11-27-16/h3-9H,2,10-11H2,1H3,(H,22,23,24,25).
What are the key properties of N-[2,6-bis(1,3-benzodioxol-5-yl)pyrimidin-4-yl]propanamide?
N-[2,6-bis(1,3-benzodioxol-5-yl)pyrimidin-4-yl]propanamide has a molecular weight of 391.38 g/mol, XLogP of 3.62, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,6-bis(1,3-benzodioxol-5-yl)pyrimidin-4-yl]propanamide is sourced from PubChem (CID 50940976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).