About N-[2,6-bis(1,3-benzodioxol-5-yl)pyrimidin-4-yl]butanamide
N-[2,6-bis(1,3-benzodioxol-5-yl)pyrimidin-4-yl]butanamide (PubChem CID 50941003) has the molecular formula C22H19N3O5
and a molecular weight of 405.41 g/mol. Its IUPAC name is N-[2,6-bis(1,3-benzodioxol-5-yl)pyrimidin-4-yl]butanamide.
Molecular Properties
| Compound Name | N-[2,6-bis(1,3-benzodioxol-5-yl)pyrimidin-4-yl]butanamide |
| PubChem CID | 50941003 |
| Molecular Formula | C22H19N3O5 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | N-[2,6-bis(1,3-benzodioxol-5-yl)pyrimidin-4-yl]butanamide |
| SMILES | CCCC(=O)Nc1cc(-c2ccc3c(c2)OCO3)nc(-c2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C22H19N3O5/c1-2-3-21(26)24-20-10-15(13-4-6-16-18(8-13)29-11-27-16)23-22(25-20)14-5-7-17-19(9-14)30-12-28-17/h4-10H,2-3,11-12H2,1H3,(H,23,24,25,26) |
| InChIKey | XHRJZEOBDDVMLG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[2,6-bis(1,3-benzodioxol-5-yl)pyrimidin-4-yl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,6-bis(1,3-benzodioxol-5-yl)pyrimidin-4-yl]butanamide?
The IUPAC name of N-[2,6-bis(1,3-benzodioxol-5-yl)pyrimidin-4-yl]butanamide (CID 50941003) is N-[2,6-bis(1,3-benzodioxol-5-yl)pyrimidin-4-yl]butanamide.
What is the SMILES notation for N-[2,6-bis(1,3-benzodioxol-5-yl)pyrimidin-4-yl]butanamide?
The canonical SMILES for N-[2,6-bis(1,3-benzodioxol-5-yl)pyrimidin-4-yl]butanamide is CCCC(=O)Nc1cc(-c2ccc3c(c2)OCO3)nc(-c2ccc3c(c2)OCO3)n1.
What is the InChIKey of N-[2,6-bis(1,3-benzodioxol-5-yl)pyrimidin-4-yl]butanamide?
The InChIKey is XHRJZEOBDDVMLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N3O5/c1-2-3-21(26)24-20-10-15(13-4-6-16-18(8-13)29-11-27-16)23-22(25-20)14-5-7-17-19(9-14)30-12-28-17/h4-10H,2-3,11-12H2,1H3,(H,23,24,25,26).
What are the key properties of N-[2,6-bis(1,3-benzodioxol-5-yl)pyrimidin-4-yl]butanamide?
N-[2,6-bis(1,3-benzodioxol-5-yl)pyrimidin-4-yl]butanamide has a molecular weight of 405.41 g/mol, XLogP of 4.01, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,6-bis(1,3-benzodioxol-5-yl)pyrimidin-4-yl]butanamide is sourced from PubChem (CID 50941003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).