C14H24OS2 — CID 50941121
(2R,4E)-4-methyl-1-(2-methyl-1,3-dithian-2-yl)octa-4,7-dien-2-ol (PubChem CID 50941121) has the molecular formula C14H24OS2 and a molecular weight of 272.48 g/mol. Its IUPAC name is (2R,4E)-4-methyl-1-(2-methyl-1,3-dithian-2-yl)octa-4,7-dien-2-ol.
| Compound Name | (2R,4E)-4-methyl-1-(2-methyl-1,3-dithian-2-yl)octa-4,7-dien-2-ol |
|---|---|
| PubChem CID | 50941121 |
| Molecular Formula | C14H24OS2 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (2R,4E)-4-methyl-1-(2-methyl-1,3-dithian-2-yl)octa-4,7-dien-2-ol |
| SMILES | C=CC/C=C(\C)C[C@@H](O)CC1(C)SCCCS1 |
| InChI | InChI=1S/C14H24OS2/c1-4-5-7-12(2)10-13(15)11-14(3)16-8-6-9-17-14/h4,7,13,15H,1,5-6,8-11H2,2-3H3/b12-7+/t13-/m1/s1 |
| InChIKey | ZAXFNPYMYKEDMO-BWODNOAJSA-N |
| XLogP | 4.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|