About (1R,6S)-4-iodo-5,5-dimethoxy-7-oxabicyclo[4.1.0]hept-3-en-2-one
(1R,6S)-4-iodo-5,5-dimethoxy-7-oxabicyclo[4.1.0]hept-3-en-2-one (PubChem CID 50941186) has the molecular formula C8H9IO4
and a molecular weight of 296.06 g/mol. Its IUPAC name is (1R,6S)-4-iodo-5,5-dimethoxy-7-oxabicyclo[4.1.0]hept-3-en-2-one.
Molecular Properties
| Compound Name | (1R,6S)-4-iodo-5,5-dimethoxy-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| PubChem CID | 50941186 |
| Molecular Formula | C8H9IO4 |
| Molecular Weight | 296.06 g/mol |
| Exact Mass | 295.95 |
| IUPAC Name | (1R,6S)-4-iodo-5,5-dimethoxy-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| SMILES | COC1(OC)C(I)=CC(=O)[C@@H]2O[C@@H]21 |
| InChI | InChI=1S/C8H9IO4/c1-11-8(12-2)5(9)3-4(10)6-7(8)13-6/h3,6-7H,1-2H3/t6-,7-/m0/s1 |
| InChIKey | SARQEJPYNXTLCC-BQBZGAKWSA-N |
| XLogP | 0.64 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.06 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (1R,6S)-4-iodo-5,5-dimethoxy-7-oxabicyclo[4.1.0]hept-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,6S)-4-iodo-5,5-dimethoxy-7-oxabicyclo[4.1.0]hept-3-en-2-one?
The IUPAC name of (1R,6S)-4-iodo-5,5-dimethoxy-7-oxabicyclo[4.1.0]hept-3-en-2-one (CID 50941186) is (1R,6S)-4-iodo-5,5-dimethoxy-7-oxabicyclo[4.1.0]hept-3-en-2-one.
What is the SMILES notation for (1R,6S)-4-iodo-5,5-dimethoxy-7-oxabicyclo[4.1.0]hept-3-en-2-one?
The canonical SMILES for (1R,6S)-4-iodo-5,5-dimethoxy-7-oxabicyclo[4.1.0]hept-3-en-2-one is COC1(OC)C(I)=CC(=O)[C@@H]2O[C@@H]21.
What is the InChIKey of (1R,6S)-4-iodo-5,5-dimethoxy-7-oxabicyclo[4.1.0]hept-3-en-2-one?
The InChIKey is SARQEJPYNXTLCC-BQBZGAKWSA-N. The full InChI is InChI=1S/C8H9IO4/c1-11-8(12-2)5(9)3-4(10)6-7(8)13-6/h3,6-7H,1-2H3/t6-,7-/m0/s1.
What are the key properties of (1R,6S)-4-iodo-5,5-dimethoxy-7-oxabicyclo[4.1.0]hept-3-en-2-one?
(1R,6S)-4-iodo-5,5-dimethoxy-7-oxabicyclo[4.1.0]hept-3-en-2-one has a molecular weight of 296.06 g/mol, XLogP of 0.64, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,6S)-4-iodo-5,5-dimethoxy-7-oxabicyclo[4.1.0]hept-3-en-2-one is sourced from PubChem (CID 50941186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).