About 6-(dimethylamino)-2,3-dihydroisoindol-1-one
6-(dimethylamino)-2,3-dihydroisoindol-1-one (PubChem CID 50941193) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is 6-(dimethylamino)-2,3-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 6-(dimethylamino)-2,3-dihydroisoindol-1-one |
| PubChem CID | 50941193 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 6-(dimethylamino)-2,3-dihydroisoindol-1-one |
| SMILES | CN(C)c1ccc2c(c1)C(=O)NC2 |
| InChI | InChI=1S/C10H12N2O/c1-12(2)8-4-3-7-6-11-10(13)9(7)5-8/h3-5H,6H2,1-2H3,(H,11,13) |
| InChIKey | BOJFFGSRCHOCNU-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(dimethylamino)-2,3-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(dimethylamino)-2,3-dihydroisoindol-1-one?
The IUPAC name of 6-(dimethylamino)-2,3-dihydroisoindol-1-one (CID 50941193) is 6-(dimethylamino)-2,3-dihydroisoindol-1-one.
What is the SMILES notation for 6-(dimethylamino)-2,3-dihydroisoindol-1-one?
The canonical SMILES for 6-(dimethylamino)-2,3-dihydroisoindol-1-one is CN(C)c1ccc2c(c1)C(=O)NC2.
What is the InChIKey of 6-(dimethylamino)-2,3-dihydroisoindol-1-one?
The InChIKey is BOJFFGSRCHOCNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O/c1-12(2)8-4-3-7-6-11-10(13)9(7)5-8/h3-5H,6H2,1-2H3,(H,11,13).
What are the key properties of 6-(dimethylamino)-2,3-dihydroisoindol-1-one?
6-(dimethylamino)-2,3-dihydroisoindol-1-one has a molecular weight of 176.22 g/mol, XLogP of 1.00, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(dimethylamino)-2,3-dihydroisoindol-1-one is sourced from PubChem (CID 50941193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).