C8H14O2 — CID 50941387
(3aS,4S,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-ol (PubChem CID 50941387) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is (3aS,4S,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-ol.
| Compound Name | (3aS,4S,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-ol |
|---|---|
| PubChem CID | 50941387 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | (3aS,4S,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-ol |
| SMILES | O[C@H]1CCC[C@H]2OCC[C@@H]12 |
| InChI | InChI=1S/C8H14O2/c9-7-2-1-3-8-6(7)4-5-10-8/h6-9H,1-5H2/t6-,7-,8+/m0/s1 |
| InChIKey | NNYXRCCCSBUROH-BIIVOSGPSA-N |
| XLogP | 0.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |