C12H15Cl3FN3O4 — CID 5094150
2,2-dimethyl-N-[2,2,2-trichloro-1-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methoxy]ethyl]propanamide (PubChem CID 5094150) has the molecular formula C12H15Cl3FN3O4 and a molecular weight of 390.63 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2,2,2-trichloro-1-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methoxy]ethyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[2,2,2-trichloro-1-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 5094150 |
| Molecular Formula | C12H15Cl3FN3O4 |
| Molecular Weight | 390.63 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | 2,2-dimethyl-N-[2,2,2-trichloro-1-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methoxy]ethyl]propanamide |
| SMILES | CC(C)(C)C(=O)NC(OCn1cc(F)c(=O)[nH]c1=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H15Cl3FN3O4/c1-11(2,3)8(21)18-9(12(13,14)15)23-5-19-4-6(16)7(20)17-10(19)22/h4,9H,5H2,1-3H3,(H,18,21)(H,17,20,22) |
| InChIKey | AUISEGVMGPOKTG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.63 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|