C24H23Cl2N3O2 — CID 50941551
(2R,8S)-6-tert-butyl-2-(3,4-dichlorophenyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 50941551) has the molecular formula C24H23Cl2N3O2 and a molecular weight of 456.37 g/mol. Its IUPAC name is (2R,8S)-6-tert-butyl-2-(3,4-dichlorophenyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | (2R,8S)-6-tert-butyl-2-(3,4-dichlorophenyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 50941551 |
| Molecular Formula | C24H23Cl2N3O2 |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | (2R,8S)-6-tert-butyl-2-(3,4-dichlorophenyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | CC(C)(C)N1CC(=O)N2[C@H](c3ccc(Cl)c(Cl)c3)c3[nH]c4ccccc4c3C[C@H]2C1=O |
| InChI | InChI=1S/C24H23Cl2N3O2/c1-24(2,3)28-12-20(30)29-19(23(28)31)11-15-14-6-4-5-7-18(14)27-21(15)22(29)13-8-9-16(25)17(26)10-13/h4-10,19,22,27H,11-12H2,1-3H3/t19-,22+/m0/s1 |
| InChIKey | FAJQXZDDJBXFSQ-SIKLNZKXSA-N |
| XLogP | 4.96 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|