About 4-anilinothieno[3,2-c]quinoline-7-carbonitrile
4-anilinothieno[3,2-c]quinoline-7-carbonitrile (PubChem CID 50941655) has the molecular formula C18H11N3S
and a molecular weight of 301.37 g/mol. Its IUPAC name is 4-anilinothieno[3,2-c]quinoline-7-carbonitrile.
Molecular Properties
| Compound Name | 4-anilinothieno[3,2-c]quinoline-7-carbonitrile |
| PubChem CID | 50941655 |
| Molecular Formula | C18H11N3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 4-anilinothieno[3,2-c]quinoline-7-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)nc(Nc1ccccc1)c1ccsc12 |
| InChI | InChI=1S/C18H11N3S/c19-11-12-6-7-14-16(10-12)21-18(15-8-9-22-17(14)15)20-13-4-2-1-3-5-13/h1-10H,(H,20,21) |
| InChIKey | YAVSHDIJXOTQSY-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-anilinothieno[3,2-c]quinoline-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-anilinothieno[3,2-c]quinoline-7-carbonitrile?
The IUPAC name of 4-anilinothieno[3,2-c]quinoline-7-carbonitrile (CID 50941655) is 4-anilinothieno[3,2-c]quinoline-7-carbonitrile.
What is the SMILES notation for 4-anilinothieno[3,2-c]quinoline-7-carbonitrile?
The canonical SMILES for 4-anilinothieno[3,2-c]quinoline-7-carbonitrile is N#Cc1ccc2c(c1)nc(Nc1ccccc1)c1ccsc12.
What is the InChIKey of 4-anilinothieno[3,2-c]quinoline-7-carbonitrile?
The InChIKey is YAVSHDIJXOTQSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11N3S/c19-11-12-6-7-14-16(10-12)21-18(15-8-9-22-17(14)15)20-13-4-2-1-3-5-13/h1-10H,(H,20,21).
What are the key properties of 4-anilinothieno[3,2-c]quinoline-7-carbonitrile?
4-anilinothieno[3,2-c]quinoline-7-carbonitrile has a molecular weight of 301.37 g/mol, XLogP of 5.06, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-anilinothieno[3,2-c]quinoline-7-carbonitrile is sourced from PubChem (CID 50941655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).