C18H24O2Si — CID 50941994
2-[(2R,3S,4E)-4-[[dimethyl(phenyl)silyl]methylidene]-2-prop-2-enyloxolan-3-yl]acetaldehyde (PubChem CID 50941994) has the molecular formula C18H24O2Si and a molecular weight of 300.47 g/mol. Its IUPAC name is 2-[(2R,3S,4E)-4-[[dimethyl(phenyl)silyl]methylidene]-2-prop-2-enyloxolan-3-yl]acetaldehyde.
| Compound Name | 2-[(2R,3S,4E)-4-[[dimethyl(phenyl)silyl]methylidene]-2-prop-2-enyloxolan-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 50941994 |
| Molecular Formula | C18H24O2Si |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 2-[(2R,3S,4E)-4-[[dimethyl(phenyl)silyl]methylidene]-2-prop-2-enyloxolan-3-yl]acetaldehyde |
| SMILES | C=CC[C@H]1OC/C(=C/[Si](C)(C)c2ccccc2)[C@@H]1CC=O |
| InChI | InChI=1S/C18H24O2Si/c1-4-8-18-17(11-12-19)15(13-20-18)14-21(2,3)16-9-6-5-7-10-16/h4-7,9-10,12,14,17-18H,1,8,11,13H2,2-3H3/b15-14-/t17-,18+/m0/s1 |
| InChIKey | LKDNOTHOPRSINK-QOQDJSECSA-N |
| XLogP | 3.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|