About 6-(3,4-dimethoxyphenyl)-4-[4-(4-methylphenyl)piperazin-1-yl]pteridin-2-amine
6-(3,4-dimethoxyphenyl)-4-[4-(4-methylphenyl)piperazin-1-yl]pteridin-2-amine (PubChem CID 50942313) has the molecular formula C25H27N7O2
and a molecular weight of 457.54 g/mol. Its IUPAC name is 6-(3,4-dimethoxyphenyl)-4-[4-(4-methylphenyl)piperazin-1-yl]pteridin-2-amine.
Molecular Properties
| Compound Name | 6-(3,4-dimethoxyphenyl)-4-[4-(4-methylphenyl)piperazin-1-yl]pteridin-2-amine |
| PubChem CID | 50942313 |
| Molecular Formula | C25H27N7O2 |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | 6-(3,4-dimethoxyphenyl)-4-[4-(4-methylphenyl)piperazin-1-yl]pteridin-2-amine |
| SMILES | COc1ccc(-c2cnc3nc(N)nc(N4CCN(c5ccc(C)cc5)CC4)c3n2)cc1OC |
| InChI | InChI=1S/C25H27N7O2/c1-16-4-7-18(8-5-16)31-10-12-32(13-11-31)24-22-23(29-25(26)30-24)27-15-19(28-22)17-6-9-20(33-2)21(14-17)34-3/h4-9,14-15H,10-13H2,1-3H3,(H2,26,27,29,30) |
| InChIKey | WATVLXDVSBDIRP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 6-(3,4-dimethoxyphenyl)-4-[4-(4-methylphenyl)piperazin-1-yl]pteridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,4-dimethoxyphenyl)-4-[4-(4-methylphenyl)piperazin-1-yl]pteridin-2-amine?
The IUPAC name of 6-(3,4-dimethoxyphenyl)-4-[4-(4-methylphenyl)piperazin-1-yl]pteridin-2-amine (CID 50942313) is 6-(3,4-dimethoxyphenyl)-4-[4-(4-methylphenyl)piperazin-1-yl]pteridin-2-amine.
What is the SMILES notation for 6-(3,4-dimethoxyphenyl)-4-[4-(4-methylphenyl)piperazin-1-yl]pteridin-2-amine?
The canonical SMILES for 6-(3,4-dimethoxyphenyl)-4-[4-(4-methylphenyl)piperazin-1-yl]pteridin-2-amine is COc1ccc(-c2cnc3nc(N)nc(N4CCN(c5ccc(C)cc5)CC4)c3n2)cc1OC.
What is the InChIKey of 6-(3,4-dimethoxyphenyl)-4-[4-(4-methylphenyl)piperazin-1-yl]pteridin-2-amine?
The InChIKey is WATVLXDVSBDIRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27N7O2/c1-16-4-7-18(8-5-16)31-10-12-32(13-11-31)24-22-23(29-25(26)30-24)27-15-19(28-22)17-6-9-20(33-2)21(14-17)34-3/h4-9,14-15H,10-13H2,1-3H3,(H2,26,27,29,30).
What are the key properties of 6-(3,4-dimethoxyphenyl)-4-[4-(4-methylphenyl)piperazin-1-yl]pteridin-2-amine?
6-(3,4-dimethoxyphenyl)-4-[4-(4-methylphenyl)piperazin-1-yl]pteridin-2-amine has a molecular weight of 457.54 g/mol, XLogP of 3.32, 5 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,4-dimethoxyphenyl)-4-[4-(4-methylphenyl)piperazin-1-yl]pteridin-2-amine is sourced from PubChem (CID 50942313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).