C16H18N4O — CID 50942419
6-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2,3,6-triazatricyclo[6.3.1.04,12]dodeca-1,4(12),8,10-tetraen-7-one (PubChem CID 50942419) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 6-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2,3,6-triazatricyclo[6.3.1.04,12]dodeca-1,4(12),8,10-tetraen-7-one.
| Compound Name | 6-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2,3,6-triazatricyclo[6.3.1.04,12]dodeca-1,4(12),8,10-tetraen-7-one |
|---|---|
| PubChem CID | 50942419 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 6-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2,3,6-triazatricyclo[6.3.1.04,12]dodeca-1,4(12),8,10-tetraen-7-one |
| SMILES | O=C1c2cccc3n[nH]c(c23)CN1[C@H]1CN2CCC1CC2 |
| InChI | InChI=1S/C16H18N4O/c21-16-11-2-1-3-12-15(11)13(18-17-12)8-20(16)14-9-19-6-4-10(14)5-7-19/h1-3,10,14H,4-9H2,(H,17,18)/t14-/m0/s1 |
| InChIKey | PPGYKWQFGNLYIY-AWEZNQCLSA-N |
| XLogP | 1.61 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |