C22H19N3O2 — CID 50942437
5-(3-phenylpropylamino)benzo[c][2,6]naphthyridine-8-carboxylic acid (PubChem CID 50942437) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is 5-(3-phenylpropylamino)benzo[c][2,6]naphthyridine-8-carboxylic acid.
| Compound Name | 5-(3-phenylpropylamino)benzo[c][2,6]naphthyridine-8-carboxylic acid |
|---|---|
| PubChem CID | 50942437 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 5-(3-phenylpropylamino)benzo[c][2,6]naphthyridine-8-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)nc(NCCCc1ccccc1)c1ccncc12 |
| InChI | InChI=1S/C22H19N3O2/c26-22(27)16-8-9-17-19-14-23-12-10-18(19)21(25-20(17)13-16)24-11-4-7-15-5-2-1-3-6-15/h1-3,5-6,8-10,12-14H,4,7,11H2,(H,24,25)(H,26,27) |
| InChIKey | MQGOUXWJBHWTTJ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|