About N-(3-chlorophenyl)-8-(2H-tetrazol-5-yl)benzo[c][2,6]naphthyridin-5-amine
N-(3-chlorophenyl)-8-(2H-tetrazol-5-yl)benzo[c][2,6]naphthyridin-5-amine (PubChem CID 50942632) has the molecular formula C19H12ClN7
and a molecular weight of 373.81 g/mol. Its IUPAC name is N-(3-chlorophenyl)-8-(2H-tetrazol-5-yl)benzo[c][2,6]naphthyridin-5-amine.
Molecular Properties
| Compound Name | N-(3-chlorophenyl)-8-(2H-tetrazol-5-yl)benzo[c][2,6]naphthyridin-5-amine |
| PubChem CID | 50942632 |
| Molecular Formula | C19H12ClN7 |
| Molecular Weight | 373.81 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | N-(3-chlorophenyl)-8-(2H-tetrazol-5-yl)benzo[c][2,6]naphthyridin-5-amine |
| SMILES | Clc1cccc(Nc2nc3cc(-c4nn[nH]n4)ccc3c3cnccc23)c1 |
| InChI | InChI=1S/C19H12ClN7/c20-12-2-1-3-13(9-12)22-19-15-6-7-21-10-16(15)14-5-4-11(8-17(14)23-19)18-24-26-27-25-18/h1-10H,(H,22,23)(H,24,25,26,27) |
| InChIKey | IGKXMIGRJGFVEE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.81 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze N-(3-chlorophenyl)-8-(2H-tetrazol-5-yl)benzo[c][2,6]naphthyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chlorophenyl)-8-(2H-tetrazol-5-yl)benzo[c][2,6]naphthyridin-5-amine?
The IUPAC name of N-(3-chlorophenyl)-8-(2H-tetrazol-5-yl)benzo[c][2,6]naphthyridin-5-amine (CID 50942632) is N-(3-chlorophenyl)-8-(2H-tetrazol-5-yl)benzo[c][2,6]naphthyridin-5-amine.
What is the SMILES notation for N-(3-chlorophenyl)-8-(2H-tetrazol-5-yl)benzo[c][2,6]naphthyridin-5-amine?
The canonical SMILES for N-(3-chlorophenyl)-8-(2H-tetrazol-5-yl)benzo[c][2,6]naphthyridin-5-amine is Clc1cccc(Nc2nc3cc(-c4nn[nH]n4)ccc3c3cnccc23)c1.
What is the InChIKey of N-(3-chlorophenyl)-8-(2H-tetrazol-5-yl)benzo[c][2,6]naphthyridin-5-amine?
The InChIKey is IGKXMIGRJGFVEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12ClN7/c20-12-2-1-3-13(9-12)22-19-15-6-7-21-10-16(15)14-5-4-11(8-17(14)23-19)18-24-26-27-25-18/h1-10H,(H,22,23)(H,24,25,26,27).
What are the key properties of N-(3-chlorophenyl)-8-(2H-tetrazol-5-yl)benzo[c][2,6]naphthyridin-5-amine?
N-(3-chlorophenyl)-8-(2H-tetrazol-5-yl)benzo[c][2,6]naphthyridin-5-amine has a molecular weight of 373.81 g/mol, XLogP of 4.36, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chlorophenyl)-8-(2H-tetrazol-5-yl)benzo[c][2,6]naphthyridin-5-amine is sourced from PubChem (CID 50942632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).