About 2-[(1R,5S)-5-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]ethyl acetate
2-[(1R,5S)-5-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]ethyl acetate (PubChem CID 50942718) has the molecular formula C15H28O3Si
and a molecular weight of 284.47 g/mol. Its IUPAC name is 2-[(1R,5S)-5-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]ethyl acetate.
Molecular Properties
| Compound Name | 2-[(1R,5S)-5-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]ethyl acetate |
| PubChem CID | 50942718 |
| Molecular Formula | C15H28O3Si |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 2-[(1R,5S)-5-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]ethyl acetate |
| SMILES | CC(=O)OCC[C@@H]1C=CC[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H28O3Si/c1-12(16)17-11-10-13-8-7-9-14(13)18-19(5,6)15(2,3)4/h7-8,13-14H,9-11H2,1-6H3/t13-,14-/m0/s1 |
| InChIKey | RQMVOJDKFBWDQK-KBPBESRZSA-N |
| XLogP | 3.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1R,5S)-5-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R,5S)-5-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]ethyl acetate?
The IUPAC name of 2-[(1R,5S)-5-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]ethyl acetate (CID 50942718) is 2-[(1R,5S)-5-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]ethyl acetate.
What is the SMILES notation for 2-[(1R,5S)-5-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]ethyl acetate?
The canonical SMILES for 2-[(1R,5S)-5-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]ethyl acetate is CC(=O)OCC[C@@H]1C=CC[C@@H]1O[Si](C)(C)C(C)(C)C.
What is the InChIKey of 2-[(1R,5S)-5-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]ethyl acetate?
The InChIKey is RQMVOJDKFBWDQK-KBPBESRZSA-N. The full InChI is InChI=1S/C15H28O3Si/c1-12(16)17-11-10-13-8-7-9-14(13)18-19(5,6)15(2,3)4/h7-8,13-14H,9-11H2,1-6H3/t13-,14-/m0/s1.
What are the key properties of 2-[(1R,5S)-5-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]ethyl acetate?
2-[(1R,5S)-5-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]ethyl acetate has a molecular weight of 284.47 g/mol, XLogP of 3.91, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,5S)-5-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]ethyl acetate is sourced from PubChem (CID 50942718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).