C24H29N3O2 — CID 50942817
ethyl 4-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-3-pyridin-4-ylbutanoate (PubChem CID 50942817) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is ethyl 4-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-3-pyridin-4-ylbutanoate.
| Compound Name | ethyl 4-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-3-pyridin-4-ylbutanoate |
|---|---|
| PubChem CID | 50942817 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | ethyl 4-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-3-pyridin-4-ylbutanoate |
| SMILES | CCOC(=O)CC(Cn1c2c(c3cc(C)ccc31)CN(C)CC2)c1ccncc1 |
| InChI | InChI=1S/C24H29N3O2/c1-4-29-24(28)14-19(18-7-10-25-11-8-18)15-27-22-6-5-17(2)13-20(22)21-16-26(3)12-9-23(21)27/h5-8,10-11,13,19H,4,9,12,14-16H2,1-3H3 |
| InChIKey | MUROOXXUIWWLQQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|