C26H33N3O2 — CID 50942885
ethyl 4-(2-ethyl-8-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-3-(2-methyl-4-pyridinyl)butanoate (PubChem CID 50942885) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is ethyl 4-(2-ethyl-8-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-3-(2-methyl-4-pyridinyl)butanoate.
| Compound Name | ethyl 4-(2-ethyl-8-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-3-(2-methyl-4-pyridinyl)butanoate |
|---|---|
| PubChem CID | 50942885 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | ethyl 4-(2-ethyl-8-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-3-(2-methyl-4-pyridinyl)butanoate |
| SMILES | CCOC(=O)CC(Cn1c2c(c3cc(C)ccc31)CN(CC)CC2)c1ccnc(C)c1 |
| InChI | InChI=1S/C26H33N3O2/c1-5-28-12-10-25-23(17-28)22-13-18(3)7-8-24(22)29(25)16-21(15-26(30)31-6-2)20-9-11-27-19(4)14-20/h7-9,11,13-14,21H,5-6,10,12,15-17H2,1-4H3 |
| InChIKey | PEFWCNIXNWXAID-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|