C33H45N7O3S — CID 50943056
1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-[4-[[4-[4-(4-methylsulfonylpiperidin-1-yl)indol-1-yl]pyrimidin-2-yl]amino]cyclohexyl]methanone (PubChem CID 50943056) has the molecular formula C33H45N7O3S and a molecular weight of 619.84 g/mol. Its IUPAC name is 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-[4-[[4-[4-(4-methylsulfonylpiperidin-1-yl)indol-1-yl]pyrimidin-2-yl]amino]cyclohexyl]methanone.
| Compound Name | 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-[4-[[4-[4-(4-methylsulfonylpiperidin-1-yl)indol-1-yl]pyrimidin-2-yl]amino]cyclohexyl]methanone |
|---|---|
| PubChem CID | 50943056 |
| Molecular Formula | C33H45N7O3S |
| Molecular Weight | 619.84 g/mol |
| Exact Mass | 619.33 |
| IUPAC Name | 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-[4-[[4-[4-(4-methylsulfonylpiperidin-1-yl)indol-1-yl]pyrimidin-2-yl]amino]cyclohexyl]methanone |
| SMILES | CS(=O)(=O)C1CCN(c2cccc3c2ccn3-c2ccnc(NC3CCC(C(=O)N4CCN5CCCCC5C4)CC3)n2)CC1 |
| InChI | InChI=1S/C33H45N7O3S/c1-44(42,43)27-13-18-38(19-14-27)29-6-4-7-30-28(29)15-20-40(30)31-12-16-34-33(36-31)35-25-10-8-24(9-11-25)32(41)39-22-21-37-17-3-2-5-26(37)23-39/h4,6-7,12,15-16,20,24-27H,2-3,5,8-11,13-14,17-19,21-23H2,1H3,(H,34,35,36) |
| InChIKey | DPRGAGXXWKETMS-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 103.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.84 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |