C17H24N2O3 — CID 50943222
1-ethyl-7-hydroxy-3,3-dimethyl-5-(2-methylpropyl)-1,5-benzodiazepine-2,4-dione (PubChem CID 50943222) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 1-ethyl-7-hydroxy-3,3-dimethyl-5-(2-methylpropyl)-1,5-benzodiazepine-2,4-dione.
| Compound Name | 1-ethyl-7-hydroxy-3,3-dimethyl-5-(2-methylpropyl)-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 50943222 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 1-ethyl-7-hydroxy-3,3-dimethyl-5-(2-methylpropyl)-1,5-benzodiazepine-2,4-dione |
| SMILES | CCN1C(=O)C(C)(C)C(=O)N(CC(C)C)c2cc(O)ccc21 |
| InChI | InChI=1S/C17H24N2O3/c1-6-18-13-8-7-12(20)9-14(13)19(10-11(2)3)16(22)17(4,5)15(18)21/h7-9,11,20H,6,10H2,1-5H3 |
| InChIKey | RZJNCGQKWOAFEB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|