About 2-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]-3-oxo-1H-isoindole-4-carboxamide
2-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]-3-oxo-1H-isoindole-4-carboxamide (PubChem CID 50943324) has the molecular formula C20H25N5O2
and a molecular weight of 367.45 g/mol. Its IUPAC name is 2-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]-3-oxo-1H-isoindole-4-carboxamide.
Molecular Properties
| Compound Name | 2-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]-3-oxo-1H-isoindole-4-carboxamide |
| PubChem CID | 50943324 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 2-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]-3-oxo-1H-isoindole-4-carboxamide |
| SMILES | Cc1c(CN2CCC(N3Cc4cccc(C(N)=O)c4C3=O)CC2)cnn1C |
| InChI | InChI=1S/C20H25N5O2/c1-13-15(10-22-23(13)2)11-24-8-6-16(7-9-24)25-12-14-4-3-5-17(19(21)26)18(14)20(25)27/h3-5,10,16H,6-9,11-12H2,1-2H3,(H2,21,26) |
| InChIKey | RMUOIWTVOGZFPR-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]-3-oxo-1H-isoindole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]-3-oxo-1H-isoindole-4-carboxamide?
The IUPAC name of 2-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]-3-oxo-1H-isoindole-4-carboxamide (CID 50943324) is 2-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]-3-oxo-1H-isoindole-4-carboxamide.
What is the SMILES notation for 2-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]-3-oxo-1H-isoindole-4-carboxamide?
The canonical SMILES for 2-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]-3-oxo-1H-isoindole-4-carboxamide is Cc1c(CN2CCC(N3Cc4cccc(C(N)=O)c4C3=O)CC2)cnn1C.
What is the InChIKey of 2-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]-3-oxo-1H-isoindole-4-carboxamide?
The InChIKey is RMUOIWTVOGZFPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N5O2/c1-13-15(10-22-23(13)2)11-24-8-6-16(7-9-24)25-12-14-4-3-5-17(19(21)26)18(14)20(25)27/h3-5,10,16H,6-9,11-12H2,1-2H3,(H2,21,26).
What are the key properties of 2-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]-3-oxo-1H-isoindole-4-carboxamide?
2-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]-3-oxo-1H-isoindole-4-carboxamide has a molecular weight of 367.45 g/mol, XLogP of 1.45, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]-3-oxo-1H-isoindole-4-carboxamide is sourced from PubChem (CID 50943324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).