C23H27N7O3S2 — CID 50943688
N-[2-[[5-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]-5-ethynylpyrimidin-2-yl]thiophen-2-yl]sulfonylamino]ethyl]-2,2-dimethylpropanamide (PubChem CID 50943688) has the molecular formula C23H27N7O3S2 and a molecular weight of 513.65 g/mol. Its IUPAC name is N-[2-[[5-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]-5-ethynylpyrimidin-2-yl]thiophen-2-yl]sulfonylamino]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[[5-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]-5-ethynylpyrimidin-2-yl]thiophen-2-yl]sulfonylamino]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 50943688 |
| Molecular Formula | C23H27N7O3S2 |
| Molecular Weight | 513.65 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | N-[2-[[5-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]-5-ethynylpyrimidin-2-yl]thiophen-2-yl]sulfonylamino]ethyl]-2,2-dimethylpropanamide |
| SMILES | C#Cc1cnc(-c2ccc(S(=O)(=O)NCCNC(=O)C(C)(C)C)s2)nc1Nc1cc(C2CC2)[nH]n1 |
| InChI | InChI=1S/C23H27N7O3S2/c1-5-14-13-25-21(28-20(14)27-18-12-16(29-30-18)15-6-7-15)17-8-9-19(34-17)35(32,33)26-11-10-24-22(31)23(2,3)4/h1,8-9,12-13,15,26H,6-7,10-11H2,2-4H3,(H,24,31)(H2,25,27,28,29,30) |
| InChIKey | PJGHFDCOJWWMMZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 141.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.65 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|