C16H32N2O3 — CID 50943912
tert-butyl N-[(2S)-4-methyl-1-[[1,1,2,2,3,4,4,4-octadeuterio-3-(trideuteriomethyl)butyl]amino]-1-oxopentan-2-yl]carbamate (PubChem CID 50943912) has the molecular formula C16H32N2O3 and a molecular weight of 311.51 g/mol. Its IUPAC name is tert-butyl N-[(2S)-4-methyl-1-[[1,1,2,2,3,4,4,4-octadeuterio-3-(trideuteriomethyl)butyl]amino]-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-4-methyl-1-[[1,1,2,2,3,4,4,4-octadeuterio-3-(trideuteriomethyl)butyl]amino]-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 50943912 |
| Molecular Formula | C16H32N2O3 |
| Molecular Weight | 311.51 g/mol |
| Exact Mass | 311.31 |
| IUPAC Name | tert-butyl N-[(2S)-4-methyl-1-[[1,1,2,2,3,4,4,4-octadeuterio-3-(trideuteriomethyl)butyl]amino]-1-oxopentan-2-yl]carbamate |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])C([2H])([2H])NC(=O)[C@H](CC(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H32N2O3/c1-11(2)8-9-17-14(19)13(10-12(3)4)18-15(20)21-16(5,6)7/h11-13H,8-10H2,1-7H3,(H,17,19)(H,18,20)/t13-/m0/s1/i1D3,2D3,8D2,9D2,11D |
| InChIKey | BNOUQVLBWIOFGQ-RODQNBOZSA-N |
| XLogP | 3.09 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |