About 5-(2,3-dichlorophenoxy)-1-methyl-2-(phenoxymethyl)pyridin-4-one
5-(2,3-dichlorophenoxy)-1-methyl-2-(phenoxymethyl)pyridin-4-one (PubChem CID 50943945) has the molecular formula C19H15Cl2NO3
and a molecular weight of 376.24 g/mol. Its IUPAC name is 5-(2,3-dichlorophenoxy)-1-methyl-2-(phenoxymethyl)pyridin-4-one.
Molecular Properties
| Compound Name | 5-(2,3-dichlorophenoxy)-1-methyl-2-(phenoxymethyl)pyridin-4-one |
| PubChem CID | 50943945 |
| Molecular Formula | C19H15Cl2NO3 |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | 5-(2,3-dichlorophenoxy)-1-methyl-2-(phenoxymethyl)pyridin-4-one |
| SMILES | Cn1cc(Oc2cccc(Cl)c2Cl)c(=O)cc1COc1ccccc1 |
| InChI | InChI=1S/C19H15Cl2NO3/c1-22-11-18(25-17-9-5-8-15(20)19(17)21)16(23)10-13(22)12-24-14-6-3-2-4-7-14/h2-11H,12H2,1H3 |
| InChIKey | OLZOEQUVNXUNAP-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2,3-dichlorophenoxy)-1-methyl-2-(phenoxymethyl)pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,3-dichlorophenoxy)-1-methyl-2-(phenoxymethyl)pyridin-4-one?
The IUPAC name of 5-(2,3-dichlorophenoxy)-1-methyl-2-(phenoxymethyl)pyridin-4-one (CID 50943945) is 5-(2,3-dichlorophenoxy)-1-methyl-2-(phenoxymethyl)pyridin-4-one.
What is the SMILES notation for 5-(2,3-dichlorophenoxy)-1-methyl-2-(phenoxymethyl)pyridin-4-one?
The canonical SMILES for 5-(2,3-dichlorophenoxy)-1-methyl-2-(phenoxymethyl)pyridin-4-one is Cn1cc(Oc2cccc(Cl)c2Cl)c(=O)cc1COc1ccccc1.
What is the InChIKey of 5-(2,3-dichlorophenoxy)-1-methyl-2-(phenoxymethyl)pyridin-4-one?
The InChIKey is OLZOEQUVNXUNAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15Cl2NO3/c1-22-11-18(25-17-9-5-8-15(20)19(17)21)16(23)10-13(22)12-24-14-6-3-2-4-7-14/h2-11H,12H2,1H3.
What are the key properties of 5-(2,3-dichlorophenoxy)-1-methyl-2-(phenoxymethyl)pyridin-4-one?
5-(2,3-dichlorophenoxy)-1-methyl-2-(phenoxymethyl)pyridin-4-one has a molecular weight of 376.24 g/mol, XLogP of 5.06, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,3-dichlorophenoxy)-1-methyl-2-(phenoxymethyl)pyridin-4-one is sourced from PubChem (CID 50943945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).