C26H27N3O — CID 50943981
2-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-1-phenyl-1-pyridin-4-ylethanol (PubChem CID 50943981) has the molecular formula C26H27N3O and a molecular weight of 397.52 g/mol. Its IUPAC name is 2-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-1-phenyl-1-pyridin-4-ylethanol.
| Compound Name | 2-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-1-phenyl-1-pyridin-4-ylethanol |
|---|---|
| PubChem CID | 50943981 |
| Molecular Formula | C26H27N3O |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 2-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-1-phenyl-1-pyridin-4-ylethanol |
| SMILES | Cc1ccc2c(c1)c1c(n2CC(O)(c2ccccc2)c2ccncc2)CCN(C)C1 |
| InChI | InChI=1S/C26H27N3O/c1-19-8-9-24-22(16-19)23-17-28(2)15-12-25(23)29(24)18-26(30,20-6-4-3-5-7-20)21-10-13-27-14-11-21/h3-11,13-14,16,30H,12,15,17-18H2,1-2H3 |
| InChIKey | HEWRNYREUNAAIV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|