About (4E)-4-benzylidene-1,3-diphenylazetidin-2-one
(4E)-4-benzylidene-1,3-diphenylazetidin-2-one (PubChem CID 50943990) has the molecular formula C22H17NO
and a molecular weight of 311.38 g/mol. Its IUPAC name is (4E)-4-benzylidene-1,3-diphenylazetidin-2-one.
Molecular Properties
| Compound Name | (4E)-4-benzylidene-1,3-diphenylazetidin-2-one |
| PubChem CID | 50943990 |
| Molecular Formula | C22H17NO |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (4E)-4-benzylidene-1,3-diphenylazetidin-2-one |
| SMILES | O=C1C(c2ccccc2)/C(=C\c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C22H17NO/c24-22-21(18-12-6-2-7-13-18)20(16-17-10-4-1-5-11-17)23(22)19-14-8-3-9-15-19/h1-16,21H/b20-16+ |
| InChIKey | CQFYKXHYICEKNG-CAPFRKAQSA-N |
| XLogP | 4.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4E)-4-benzylidene-1,3-diphenylazetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-4-benzylidene-1,3-diphenylazetidin-2-one?
The IUPAC name of (4E)-4-benzylidene-1,3-diphenylazetidin-2-one (CID 50943990) is (4E)-4-benzylidene-1,3-diphenylazetidin-2-one.
What is the SMILES notation for (4E)-4-benzylidene-1,3-diphenylazetidin-2-one?
The canonical SMILES for (4E)-4-benzylidene-1,3-diphenylazetidin-2-one is O=C1C(c2ccccc2)/C(=C\c2ccccc2)N1c1ccccc1.
What is the InChIKey of (4E)-4-benzylidene-1,3-diphenylazetidin-2-one?
The InChIKey is CQFYKXHYICEKNG-CAPFRKAQSA-N. The full InChI is InChI=1S/C22H17NO/c24-22-21(18-12-6-2-7-13-18)20(16-17-10-4-1-5-11-17)23(22)19-14-8-3-9-15-19/h1-16,21H/b20-16+.
What are the key properties of (4E)-4-benzylidene-1,3-diphenylazetidin-2-one?
(4E)-4-benzylidene-1,3-diphenylazetidin-2-one has a molecular weight of 311.38 g/mol, XLogP of 4.86, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-4-benzylidene-1,3-diphenylazetidin-2-one is sourced from PubChem (CID 50943990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).