About (3,5-dimethyl-1-propylpyrazol-4-yl)methanamine;hydrate;dihydrochloride
(3,5-dimethyl-1-propylpyrazol-4-yl)methanamine;hydrate;dihydrochloride (PubChem CID 50944252) has the molecular formula C9H21Cl2N3O
and a molecular weight of 258.19 g/mol. Its IUPAC name is (3,5-dimethyl-1-propylpyrazol-4-yl)methanamine;hydrate;dihydrochloride.
Molecular Properties
| Compound Name | (3,5-dimethyl-1-propylpyrazol-4-yl)methanamine;hydrate;dihydrochloride |
| PubChem CID | 50944252 |
| Molecular Formula | C9H21Cl2N3O |
| Molecular Weight | 258.19 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | (3,5-dimethyl-1-propylpyrazol-4-yl)methanamine;hydrate;dihydrochloride |
| SMILES | CCCn1nc(C)c(CN)c1C.Cl.Cl.O |
| InChI | InChI=1S/C9H17N3.2ClH.H2O/c1-4-5-12-8(3)9(6-10)7(2)11-12;;;/h4-6,10H2,1-3H3;2*1H;1H2 |
| InChIKey | QMMYUVOZBFBGAS-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.19 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3,5-dimethyl-1-propylpyrazol-4-yl)methanamine;hydrate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dimethyl-1-propylpyrazol-4-yl)methanamine;hydrate;dihydrochloride?
The IUPAC name of (3,5-dimethyl-1-propylpyrazol-4-yl)methanamine;hydrate;dihydrochloride (CID 50944252) is (3,5-dimethyl-1-propylpyrazol-4-yl)methanamine;hydrate;dihydrochloride.
What is the SMILES notation for (3,5-dimethyl-1-propylpyrazol-4-yl)methanamine;hydrate;dihydrochloride?
The canonical SMILES for (3,5-dimethyl-1-propylpyrazol-4-yl)methanamine;hydrate;dihydrochloride is CCCn1nc(C)c(CN)c1C.Cl.Cl.O.
What is the InChIKey of (3,5-dimethyl-1-propylpyrazol-4-yl)methanamine;hydrate;dihydrochloride?
The InChIKey is QMMYUVOZBFBGAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3.2ClH.H2O/c1-4-5-12-8(3)9(6-10)7(2)11-12;;;/h4-6,10H2,1-3H3;2*1H;1H2.
What are the key properties of (3,5-dimethyl-1-propylpyrazol-4-yl)methanamine;hydrate;dihydrochloride?
(3,5-dimethyl-1-propylpyrazol-4-yl)methanamine;hydrate;dihydrochloride has a molecular weight of 258.19 g/mol, XLogP of 1.39, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dimethyl-1-propylpyrazol-4-yl)methanamine;hydrate;dihydrochloride is sourced from PubChem (CID 50944252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).