About 2-amino-1,3,8-triazaspiro[4.5]dec-1-en-4-one;dihydrochloride
2-amino-1,3,8-triazaspiro[4.5]dec-1-en-4-one;dihydrochloride (PubChem CID 50944314) has the molecular formula C7H14Cl2N4O
and a molecular weight of 241.12 g/mol. Its IUPAC name is 2-amino-1,3,8-triazaspiro[4.5]dec-1-en-4-one;dihydrochloride.
Molecular Properties
| Compound Name | 2-amino-1,3,8-triazaspiro[4.5]dec-1-en-4-one;dihydrochloride |
| PubChem CID | 50944314 |
| Molecular Formula | C7H14Cl2N4O |
| Molecular Weight | 241.12 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 2-amino-1,3,8-triazaspiro[4.5]dec-1-en-4-one;dihydrochloride |
| SMILES | Cl.Cl.NC1=NC2(CCNCC2)C(=O)N1 |
| InChI | InChI=1S/C7H12N4O.2ClH/c8-6-10-5(12)7(11-6)1-3-9-4-2-7;;/h9H,1-4H2,(H3,8,10,11,12);2*1H |
| InChIKey | WYTIOEQRJCJGHZ-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.12 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-1,3,8-triazaspiro[4.5]dec-1-en-4-one;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1,3,8-triazaspiro[4.5]dec-1-en-4-one;dihydrochloride?
The IUPAC name of 2-amino-1,3,8-triazaspiro[4.5]dec-1-en-4-one;dihydrochloride (CID 50944314) is 2-amino-1,3,8-triazaspiro[4.5]dec-1-en-4-one;dihydrochloride.
What is the SMILES notation for 2-amino-1,3,8-triazaspiro[4.5]dec-1-en-4-one;dihydrochloride?
The canonical SMILES for 2-amino-1,3,8-triazaspiro[4.5]dec-1-en-4-one;dihydrochloride is Cl.Cl.NC1=NC2(CCNCC2)C(=O)N1.
What is the InChIKey of 2-amino-1,3,8-triazaspiro[4.5]dec-1-en-4-one;dihydrochloride?
The InChIKey is WYTIOEQRJCJGHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O.2ClH/c8-6-10-5(12)7(11-6)1-3-9-4-2-7;;/h9H,1-4H2,(H3,8,10,11,12);2*1H.
What are the key properties of 2-amino-1,3,8-triazaspiro[4.5]dec-1-en-4-one;dihydrochloride?
2-amino-1,3,8-triazaspiro[4.5]dec-1-en-4-one;dihydrochloride has a molecular weight of 241.12 g/mol, XLogP of -0.60, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1,3,8-triazaspiro[4.5]dec-1-en-4-one;dihydrochloride is sourced from PubChem (CID 50944314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).