About 2-amino-1,3,8-triazaspiro[4.5]dec-1-en-4-one
2-amino-1,3,8-triazaspiro[4.5]dec-1-en-4-one (PubChem CID 50944315) has the molecular formula C7H12N4O
and a molecular weight of 168.20 g/mol. Its IUPAC name is 2-amino-1,3,8-triazaspiro[4.5]dec-1-en-4-one.
Molecular Properties
| Compound Name | 2-amino-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| PubChem CID | 50944315 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 2-amino-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| SMILES | NC1=NC2(CCNCC2)C(=O)N1 |
| InChI | InChI=1S/C7H12N4O/c8-6-10-5(12)7(11-6)1-3-9-4-2-7/h9H,1-4H2,(H3,8,10,11,12) |
| InChIKey | TXVFSPSHCYEXGF-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-1,3,8-triazaspiro[4.5]dec-1-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1,3,8-triazaspiro[4.5]dec-1-en-4-one?
The IUPAC name of 2-amino-1,3,8-triazaspiro[4.5]dec-1-en-4-one (CID 50944315) is 2-amino-1,3,8-triazaspiro[4.5]dec-1-en-4-one.
What is the SMILES notation for 2-amino-1,3,8-triazaspiro[4.5]dec-1-en-4-one?
The canonical SMILES for 2-amino-1,3,8-triazaspiro[4.5]dec-1-en-4-one is NC1=NC2(CCNCC2)C(=O)N1.
What is the InChIKey of 2-amino-1,3,8-triazaspiro[4.5]dec-1-en-4-one?
The InChIKey is TXVFSPSHCYEXGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O/c8-6-10-5(12)7(11-6)1-3-9-4-2-7/h9H,1-4H2,(H3,8,10,11,12).
What are the key properties of 2-amino-1,3,8-triazaspiro[4.5]dec-1-en-4-one?
2-amino-1,3,8-triazaspiro[4.5]dec-1-en-4-one has a molecular weight of 168.20 g/mol, XLogP of -1.45, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1,3,8-triazaspiro[4.5]dec-1-en-4-one is sourced from PubChem (CID 50944315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).