C15H12N4S — CID 50946465
11-ethyl-7-phenyl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 50946465) has the molecular formula C15H12N4S and a molecular weight of 280.36 g/mol. Its IUPAC name is 11-ethyl-7-phenyl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 11-ethyl-7-phenyl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 50946465 |
| Molecular Formula | C15H12N4S |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 11-ethyl-7-phenyl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | CCc1cc2c(nc(-c3ccccc3)n3cnnc23)s1 |
| InChI | InChI=1S/C15H12N4S/c1-2-11-8-12-14-18-16-9-19(14)13(17-15(12)20-11)10-6-4-3-5-7-10/h3-9H,2H2,1H3 |
| InChIKey | UAEPLOLADUDLSJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |