About N,2-dimethyl-N-[[2-(methylamino)pyrimidin-5-yl]methyl]-1,3-thiazole-4-carboxamide
N,2-dimethyl-N-[[2-(methylamino)pyrimidin-5-yl]methyl]-1,3-thiazole-4-carboxamide (PubChem CID 50948058) has the molecular formula C12H15N5OS
and a molecular weight of 277.35 g/mol. Its IUPAC name is N,2-dimethyl-N-[[2-(methylamino)pyrimidin-5-yl]methyl]-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | N,2-dimethyl-N-[[2-(methylamino)pyrimidin-5-yl]methyl]-1,3-thiazole-4-carboxamide |
| PubChem CID | 50948058 |
| Molecular Formula | C12H15N5OS |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | N,2-dimethyl-N-[[2-(methylamino)pyrimidin-5-yl]methyl]-1,3-thiazole-4-carboxamide |
| SMILES | CNc1ncc(CN(C)C(=O)c2csc(C)n2)cn1 |
| InChI | InChI=1S/C12H15N5OS/c1-8-16-10(7-19-8)11(18)17(3)6-9-4-14-12(13-2)15-5-9/h4-5,7H,6H2,1-3H3,(H,13,14,15) |
| InChIKey | NQADAUYBOIMPLM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N,2-dimethyl-N-[[2-(methylamino)pyrimidin-5-yl]methyl]-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-dimethyl-N-[[2-(methylamino)pyrimidin-5-yl]methyl]-1,3-thiazole-4-carboxamide?
The IUPAC name of N,2-dimethyl-N-[[2-(methylamino)pyrimidin-5-yl]methyl]-1,3-thiazole-4-carboxamide (CID 50948058) is N,2-dimethyl-N-[[2-(methylamino)pyrimidin-5-yl]methyl]-1,3-thiazole-4-carboxamide.
What is the SMILES notation for N,2-dimethyl-N-[[2-(methylamino)pyrimidin-5-yl]methyl]-1,3-thiazole-4-carboxamide?
The canonical SMILES for N,2-dimethyl-N-[[2-(methylamino)pyrimidin-5-yl]methyl]-1,3-thiazole-4-carboxamide is CNc1ncc(CN(C)C(=O)c2csc(C)n2)cn1.
What is the InChIKey of N,2-dimethyl-N-[[2-(methylamino)pyrimidin-5-yl]methyl]-1,3-thiazole-4-carboxamide?
The InChIKey is NQADAUYBOIMPLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N5OS/c1-8-16-10(7-19-8)11(18)17(3)6-9-4-14-12(13-2)15-5-9/h4-5,7H,6H2,1-3H3,(H,13,14,15).
What are the key properties of N,2-dimethyl-N-[[2-(methylamino)pyrimidin-5-yl]methyl]-1,3-thiazole-4-carboxamide?
N,2-dimethyl-N-[[2-(methylamino)pyrimidin-5-yl]methyl]-1,3-thiazole-4-carboxamide has a molecular weight of 277.35 g/mol, XLogP of 1.56, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-dimethyl-N-[[2-(methylamino)pyrimidin-5-yl]methyl]-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 50948058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).