About N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-4-(4-methylphenoxy)piperidine-4-carboxamide
N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-4-(4-methylphenoxy)piperidine-4-carboxamide (PubChem CID 50948340) has the molecular formula C19H26N4O3
and a molecular weight of 358.44 g/mol. Its IUPAC name is N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-4-(4-methylphenoxy)piperidine-4-carboxamide.
Molecular Properties
| Compound Name | N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-4-(4-methylphenoxy)piperidine-4-carboxamide |
| PubChem CID | 50948340 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-4-(4-methylphenoxy)piperidine-4-carboxamide |
| SMILES | CCc1nc(CN(C)C(=O)C2(Oc3ccc(C)cc3)CCNCC2)no1 |
| InChI | InChI=1S/C19H26N4O3/c1-4-17-21-16(22-26-17)13-23(3)18(24)19(9-11-20-12-10-19)25-15-7-5-14(2)6-8-15/h5-8,20H,4,9-13H2,1-3H3 |
| InChIKey | YYHHKYOBKSMSOX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-4-(4-methylphenoxy)piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-4-(4-methylphenoxy)piperidine-4-carboxamide?
The IUPAC name of N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-4-(4-methylphenoxy)piperidine-4-carboxamide (CID 50948340) is N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-4-(4-methylphenoxy)piperidine-4-carboxamide.
What is the SMILES notation for N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-4-(4-methylphenoxy)piperidine-4-carboxamide?
The canonical SMILES for N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-4-(4-methylphenoxy)piperidine-4-carboxamide is CCc1nc(CN(C)C(=O)C2(Oc3ccc(C)cc3)CCNCC2)no1.
What is the InChIKey of N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-4-(4-methylphenoxy)piperidine-4-carboxamide?
The InChIKey is YYHHKYOBKSMSOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N4O3/c1-4-17-21-16(22-26-17)13-23(3)18(24)19(9-11-20-12-10-19)25-15-7-5-14(2)6-8-15/h5-8,20H,4,9-13H2,1-3H3.
What are the key properties of N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-4-(4-methylphenoxy)piperidine-4-carboxamide?
N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-4-(4-methylphenoxy)piperidine-4-carboxamide has a molecular weight of 358.44 g/mol, XLogP of 2.10, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-methyl-4-(4-methylphenoxy)piperidine-4-carboxamide is sourced from PubChem (CID 50948340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).