C17H20N6O2 — CID 50948448
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-propan-2-yl-5-[2-(1,2,4-triazol-1-yl)ethyl]-1,2,4-triazole (PubChem CID 50948448) has the molecular formula C17H20N6O2 and a molecular weight of 340.39 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-propan-2-yl-5-[2-(1,2,4-triazol-1-yl)ethyl]-1,2,4-triazole.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-propan-2-yl-5-[2-(1,2,4-triazol-1-yl)ethyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 50948448 |
| Molecular Formula | C17H20N6O2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-propan-2-yl-5-[2-(1,2,4-triazol-1-yl)ethyl]-1,2,4-triazole |
| SMILES | CC(C)c1nc(CCn2cncn2)n(-c2ccc3c(c2)OCCO3)n1 |
| InChI | InChI=1S/C17H20N6O2/c1-12(2)17-20-16(5-6-22-11-18-10-19-22)23(21-17)13-3-4-14-15(9-13)25-8-7-24-14/h3-4,9-12H,5-8H2,1-2H3 |
| InChIKey | AEGFOQNSIWNLIG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 79.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |