About 2-(3-phenylpropyl)-4-(4,4,4-trifluorobutyl)morpholine
2-(3-phenylpropyl)-4-(4,4,4-trifluorobutyl)morpholine (PubChem CID 50948572) has the molecular formula C17H24F3NO
and a molecular weight of 315.38 g/mol. Its IUPAC name is 2-(3-phenylpropyl)-4-(4,4,4-trifluorobutyl)morpholine.
Molecular Properties
| Compound Name | 2-(3-phenylpropyl)-4-(4,4,4-trifluorobutyl)morpholine |
| PubChem CID | 50948572 |
| Molecular Formula | C17H24F3NO |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 2-(3-phenylpropyl)-4-(4,4,4-trifluorobutyl)morpholine |
| SMILES | FC(F)(F)CCCN1CCOC(CCCc2ccccc2)C1 |
| InChI | InChI=1S/C17H24F3NO/c18-17(19,20)10-5-11-21-12-13-22-16(14-21)9-4-8-15-6-2-1-3-7-15/h1-3,6-7,16H,4-5,8-14H2 |
| InChIKey | KABJRJLBWTZLFC-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-phenylpropyl)-4-(4,4,4-trifluorobutyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-phenylpropyl)-4-(4,4,4-trifluorobutyl)morpholine?
The IUPAC name of 2-(3-phenylpropyl)-4-(4,4,4-trifluorobutyl)morpholine (CID 50948572) is 2-(3-phenylpropyl)-4-(4,4,4-trifluorobutyl)morpholine.
What is the SMILES notation for 2-(3-phenylpropyl)-4-(4,4,4-trifluorobutyl)morpholine?
The canonical SMILES for 2-(3-phenylpropyl)-4-(4,4,4-trifluorobutyl)morpholine is FC(F)(F)CCCN1CCOC(CCCc2ccccc2)C1.
What is the InChIKey of 2-(3-phenylpropyl)-4-(4,4,4-trifluorobutyl)morpholine?
The InChIKey is KABJRJLBWTZLFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24F3NO/c18-17(19,20)10-5-11-21-12-13-22-16(14-21)9-4-8-15-6-2-1-3-7-15/h1-3,6-7,16H,4-5,8-14H2.
What are the key properties of 2-(3-phenylpropyl)-4-(4,4,4-trifluorobutyl)morpholine?
2-(3-phenylpropyl)-4-(4,4,4-trifluorobutyl)morpholine has a molecular weight of 315.38 g/mol, XLogP of 4.05, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-phenylpropyl)-4-(4,4,4-trifluorobutyl)morpholine is sourced from PubChem (CID 50948572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).