C19H19N5O — CID 50948618
5-(3,5-dimethyl-1H-indole-2-carbonyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carbonitrile (PubChem CID 50948618) has the molecular formula C19H19N5O and a molecular weight of 333.40 g/mol. Its IUPAC name is 5-(3,5-dimethyl-1H-indole-2-carbonyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carbonitrile.
| Compound Name | 5-(3,5-dimethyl-1H-indole-2-carbonyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carbonitrile |
|---|---|
| PubChem CID | 50948618 |
| Molecular Formula | C19H19N5O |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 5-(3,5-dimethyl-1H-indole-2-carbonyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carbonitrile |
| SMILES | Cc1ccc2[nH]c(C(=O)N3CCCn4nc(C#N)cc4C3)c(C)c2c1 |
| InChI | InChI=1S/C19H19N5O/c1-12-4-5-17-16(8-12)13(2)18(21-17)19(25)23-6-3-7-24-15(11-23)9-14(10-20)22-24/h4-5,8-9,21H,3,6-7,11H2,1-2H3 |
| InChIKey | IOXALHBGUIIGLP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 77.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|