C18H22N4O4 — CID 5094867
1-hydroxy-3-[2-[[hydroxy-(4-methylphenyl)carbamoyl]amino]ethyl]-1-(4-methylphenyl)urea (PubChem CID 5094867) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is 1-hydroxy-3-[2-[[hydroxy-(4-methylphenyl)carbamoyl]amino]ethyl]-1-(4-methylphenyl)urea.
| Compound Name | 1-hydroxy-3-[2-[[hydroxy-(4-methylphenyl)carbamoyl]amino]ethyl]-1-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 5094867 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 1-hydroxy-3-[2-[[hydroxy-(4-methylphenyl)carbamoyl]amino]ethyl]-1-(4-methylphenyl)urea |
| SMILES | Cc1ccc(N(O)C(=O)NCCNC(=O)N(O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H22N4O4/c1-13-3-7-15(8-4-13)21(25)17(23)19-11-12-20-18(24)22(26)16-9-5-14(2)6-10-16/h3-10,25-26H,11-12H2,1-2H3,(H,19,23)(H,20,24) |
| InChIKey | UXBQORSIQJOSJX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|