C14H15N5O2 — CID 50948711
1,3-dimethyl-5-[(3-phenyl-1H-1,2,4-triazol-5-yl)methyl]imidazolidine-2,4-dione (PubChem CID 50948711) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 1,3-dimethyl-5-[(3-phenyl-1H-1,2,4-triazol-5-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 1,3-dimethyl-5-[(3-phenyl-1H-1,2,4-triazol-5-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 50948711 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 1,3-dimethyl-5-[(3-phenyl-1H-1,2,4-triazol-5-yl)methyl]imidazolidine-2,4-dione |
| SMILES | CN1C(=O)C(Cc2nc(-c3ccccc3)n[nH]2)N(C)C1=O |
| InChI | InChI=1S/C14H15N5O2/c1-18-10(13(20)19(2)14(18)21)8-11-15-12(17-16-11)9-6-4-3-5-7-9/h3-7,10H,8H2,1-2H3,(H,15,16,17) |
| InChIKey | YLQPWKLYGMUYLD-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|