About (2R,6S)-2,6-dimethyl-4-[4-(4-methylphenyl)-5-pyrimidin-5-ylpyrimidin-2-yl]morpholine
(2R,6S)-2,6-dimethyl-4-[4-(4-methylphenyl)-5-pyrimidin-5-ylpyrimidin-2-yl]morpholine (PubChem CID 50948843) has the molecular formula C21H23N5O
and a molecular weight of 361.45 g/mol. Its IUPAC name is (2R,6S)-2,6-dimethyl-4-[4-(4-methylphenyl)-5-pyrimidin-5-ylpyrimidin-2-yl]morpholine.
Molecular Properties
| Compound Name | (2R,6S)-2,6-dimethyl-4-[4-(4-methylphenyl)-5-pyrimidin-5-ylpyrimidin-2-yl]morpholine |
| PubChem CID | 50948843 |
| Molecular Formula | C21H23N5O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | (2R,6S)-2,6-dimethyl-4-[4-(4-methylphenyl)-5-pyrimidin-5-ylpyrimidin-2-yl]morpholine |
| SMILES | Cc1ccc(-c2nc(N3C[C@@H](C)O[C@@H](C)C3)ncc2-c2cncnc2)cc1 |
| InChI | InChI=1S/C21H23N5O/c1-14-4-6-17(7-5-14)20-19(18-8-22-13-23-9-18)10-24-21(25-20)26-11-15(2)27-16(3)12-26/h4-10,13,15-16H,11-12H2,1-3H3/t15-,16+ |
| InChIKey | YUGHQOVKPVCNQF-IYBDPMFKSA-N |
| XLogP | 3.52 |
| TPSA | 64.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2R,6S)-2,6-dimethyl-4-[4-(4-methylphenyl)-5-pyrimidin-5-ylpyrimidin-2-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,6S)-2,6-dimethyl-4-[4-(4-methylphenyl)-5-pyrimidin-5-ylpyrimidin-2-yl]morpholine?
The IUPAC name of (2R,6S)-2,6-dimethyl-4-[4-(4-methylphenyl)-5-pyrimidin-5-ylpyrimidin-2-yl]morpholine (CID 50948843) is (2R,6S)-2,6-dimethyl-4-[4-(4-methylphenyl)-5-pyrimidin-5-ylpyrimidin-2-yl]morpholine.
What is the SMILES notation for (2R,6S)-2,6-dimethyl-4-[4-(4-methylphenyl)-5-pyrimidin-5-ylpyrimidin-2-yl]morpholine?
The canonical SMILES for (2R,6S)-2,6-dimethyl-4-[4-(4-methylphenyl)-5-pyrimidin-5-ylpyrimidin-2-yl]morpholine is Cc1ccc(-c2nc(N3C[C@@H](C)O[C@@H](C)C3)ncc2-c2cncnc2)cc1.
What is the InChIKey of (2R,6S)-2,6-dimethyl-4-[4-(4-methylphenyl)-5-pyrimidin-5-ylpyrimidin-2-yl]morpholine?
The InChIKey is YUGHQOVKPVCNQF-IYBDPMFKSA-N. The full InChI is InChI=1S/C21H23N5O/c1-14-4-6-17(7-5-14)20-19(18-8-22-13-23-9-18)10-24-21(25-20)26-11-15(2)27-16(3)12-26/h4-10,13,15-16H,11-12H2,1-3H3/t15-,16+.
What are the key properties of (2R,6S)-2,6-dimethyl-4-[4-(4-methylphenyl)-5-pyrimidin-5-ylpyrimidin-2-yl]morpholine?
(2R,6S)-2,6-dimethyl-4-[4-(4-methylphenyl)-5-pyrimidin-5-ylpyrimidin-2-yl]morpholine has a molecular weight of 361.45 g/mol, XLogP of 3.52, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,6S)-2,6-dimethyl-4-[4-(4-methylphenyl)-5-pyrimidin-5-ylpyrimidin-2-yl]morpholine is sourced from PubChem (CID 50948843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).