C17H25N5O2 — CID 50948928
(3aR,6aR)-N-[[1-(methoxymethyl)cyclopropyl]methyl]-5-pyrimidin-2-yl-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide (PubChem CID 50948928) has the molecular formula C17H25N5O2 and a molecular weight of 331.42 g/mol. Its IUPAC name is (3aR,6aR)-N-[[1-(methoxymethyl)cyclopropyl]methyl]-5-pyrimidin-2-yl-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide.
| Compound Name | (3aR,6aR)-N-[[1-(methoxymethyl)cyclopropyl]methyl]-5-pyrimidin-2-yl-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide |
|---|---|
| PubChem CID | 50948928 |
| Molecular Formula | C17H25N5O2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | (3aR,6aR)-N-[[1-(methoxymethyl)cyclopropyl]methyl]-5-pyrimidin-2-yl-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide |
| SMILES | COCC1(CNC(=O)[C@@]23CNC[C@@H]2CN(c2ncccn2)C3)CC1 |
| InChI | InChI=1S/C17H25N5O2/c1-24-12-16(3-4-16)9-21-14(23)17-10-18-7-13(17)8-22(11-17)15-19-5-2-6-20-15/h2,5-6,13,18H,3-4,7-12H2,1H3,(H,21,23)/t13-,17-/m1/s1 |
| InChIKey | JQZVQHVQCNYRHB-CXAGYDPISA-N |
| XLogP | 0.05 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |