About N-[(4-ethyl-2-methyl-1,3-thiazol-5-yl)methyl]-2-(2-ethylsulfanyl-1,3-thiazol-4-yl)acetamide
N-[(4-ethyl-2-methyl-1,3-thiazol-5-yl)methyl]-2-(2-ethylsulfanyl-1,3-thiazol-4-yl)acetamide (PubChem CID 50949388) has the molecular formula C14H19N3OS3
and a molecular weight of 341.53 g/mol. Its IUPAC name is N-[(4-ethyl-2-methyl-1,3-thiazol-5-yl)methyl]-2-(2-ethylsulfanyl-1,3-thiazol-4-yl)acetamide.
Molecular Properties
| Compound Name | N-[(4-ethyl-2-methyl-1,3-thiazol-5-yl)methyl]-2-(2-ethylsulfanyl-1,3-thiazol-4-yl)acetamide |
| PubChem CID | 50949388 |
| Molecular Formula | C14H19N3OS3 |
| Molecular Weight | 341.53 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | N-[(4-ethyl-2-methyl-1,3-thiazol-5-yl)methyl]-2-(2-ethylsulfanyl-1,3-thiazol-4-yl)acetamide |
| SMILES | CCSc1nc(CC(=O)NCc2sc(C)nc2CC)cs1 |
| InChI | InChI=1S/C14H19N3OS3/c1-4-11-12(21-9(3)16-11)7-15-13(18)6-10-8-20-14(17-10)19-5-2/h8H,4-7H2,1-3H3,(H,15,18) |
| InChIKey | ZSDRWKRDXJLIHF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.53 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(4-ethyl-2-methyl-1,3-thiazol-5-yl)methyl]-2-(2-ethylsulfanyl-1,3-thiazol-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-ethyl-2-methyl-1,3-thiazol-5-yl)methyl]-2-(2-ethylsulfanyl-1,3-thiazol-4-yl)acetamide?
The IUPAC name of N-[(4-ethyl-2-methyl-1,3-thiazol-5-yl)methyl]-2-(2-ethylsulfanyl-1,3-thiazol-4-yl)acetamide (CID 50949388) is N-[(4-ethyl-2-methyl-1,3-thiazol-5-yl)methyl]-2-(2-ethylsulfanyl-1,3-thiazol-4-yl)acetamide.
What is the SMILES notation for N-[(4-ethyl-2-methyl-1,3-thiazol-5-yl)methyl]-2-(2-ethylsulfanyl-1,3-thiazol-4-yl)acetamide?
The canonical SMILES for N-[(4-ethyl-2-methyl-1,3-thiazol-5-yl)methyl]-2-(2-ethylsulfanyl-1,3-thiazol-4-yl)acetamide is CCSc1nc(CC(=O)NCc2sc(C)nc2CC)cs1.
What is the InChIKey of N-[(4-ethyl-2-methyl-1,3-thiazol-5-yl)methyl]-2-(2-ethylsulfanyl-1,3-thiazol-4-yl)acetamide?
The InChIKey is ZSDRWKRDXJLIHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3OS3/c1-4-11-12(21-9(3)16-11)7-15-13(18)6-10-8-20-14(17-10)19-5-2/h8H,4-7H2,1-3H3,(H,15,18).
What are the key properties of N-[(4-ethyl-2-methyl-1,3-thiazol-5-yl)methyl]-2-(2-ethylsulfanyl-1,3-thiazol-4-yl)acetamide?
N-[(4-ethyl-2-methyl-1,3-thiazol-5-yl)methyl]-2-(2-ethylsulfanyl-1,3-thiazol-4-yl)acetamide has a molecular weight of 341.53 g/mol, XLogP of 3.44, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-ethyl-2-methyl-1,3-thiazol-5-yl)methyl]-2-(2-ethylsulfanyl-1,3-thiazol-4-yl)acetamide is sourced from PubChem (CID 50949388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).