C17H27N5O2 — CID 50949858
(3aR,6aR)-5-cyclopentyl-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 50949858) has the molecular formula C17H27N5O2 and a molecular weight of 333.44 g/mol. Its IUPAC name is (3aR,6aR)-5-cyclopentyl-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,6aR)-5-cyclopentyl-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 50949858 |
| Molecular Formula | C17H27N5O2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | (3aR,6aR)-5-cyclopentyl-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | CCn1ncnc1CN1C[C@@H]2CN(C3CCCC3)C[C@]2(C(=O)O)C1 |
| InChI | InChI=1S/C17H27N5O2/c1-2-22-15(18-12-19-22)9-20-7-13-8-21(14-5-3-4-6-14)11-17(13,10-20)16(23)24/h12-14H,2-11H2,1H3,(H,23,24)/t13-,17-/m1/s1 |
| InChIKey | MJWNYMWLFXZAFI-CXAGYDPISA-N |
| XLogP | 1.06 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |