C20H21NO2S — CID 50949877
5-acetyl-N-(2-methylpropyl)-N-(3-phenylprop-2-ynyl)thiophene-2-carboxamide (PubChem CID 50949877) has the molecular formula C20H21NO2S and a molecular weight of 339.46 g/mol. Its IUPAC name is 5-acetyl-N-(2-methylpropyl)-N-(3-phenylprop-2-ynyl)thiophene-2-carboxamide.
| Compound Name | 5-acetyl-N-(2-methylpropyl)-N-(3-phenylprop-2-ynyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 50949877 |
| Molecular Formula | C20H21NO2S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 5-acetyl-N-(2-methylpropyl)-N-(3-phenylprop-2-ynyl)thiophene-2-carboxamide |
| SMILES | CC(=O)c1ccc(C(=O)N(CC#Cc2ccccc2)CC(C)C)s1 |
| InChI | InChI=1S/C20H21NO2S/c1-15(2)14-21(13-7-10-17-8-5-4-6-9-17)20(23)19-12-11-18(24-19)16(3)22/h4-6,8-9,11-12,15H,13-14H2,1-3H3 |
| InChIKey | CZQLTNUVTDHCPG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|